CAS 1379811-60-5 is the registry number for 6-Chloro-n,n'-bis(3-chloro-4-methylphenyl)-1,3,5-triazine-2,4-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-chloro-2-N,4-N-bis(3-chloro-4-methylphenyl)-1,3,5-triazine-2,4-diamine (CAS 1379811-60-5) is a chemical compound with the molecular formula C17H14Cl3N5 and a molecular weight of 394.7 g/mol. IUPAC name: 6-chloro-2-N,4-N-bis(3-chloro-4-methylphenyl)-1,3,5-triazine-2,4-diamine. InChIKey: RYPSONGPRXDGKO-UHFFFAOYSA-N.
| Molecular formula | C17H14Cl3N5 |
|---|---|
| Molecular weight | 394.7 g/mol |
| IUPAC name | 6-chloro-2-N,4-N-bis(3-chloro-4-methylphenyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | RYPSONGPRXDGKO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC2=NC(=NC(=N2)Cl)NC3=CC(=C(C=C3)C)Cl)Cl |
Computed by PubChem (NCBI)