CAS 1379812-05-1 is the registry number for 5-(Pentafluorosulfanyl)benzooxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1,3-benzoxazol-5-yl(pentafluoro)-lambda6-sulfane (CAS 1379812-05-1) is a chemical compound with the molecular formula C7H4F5NOS and a molecular weight of 245.17 g/mol. IUPAC name: 1,3-benzoxazol-5-yl(pentafluoro)-lambda6-sulfane. InChIKey: RDYQMSOJDMEGFL-UHFFFAOYSA-N.
| Molecular formula | C7H4F5NOS |
|---|---|
| Molecular weight | 245.17 g/mol |
| IUPAC name | 1,3-benzoxazol-5-yl(pentafluoro)-lambda6-sulfane |
| InChIKey | RDYQMSOJDMEGFL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1S(F)(F)(F)(F)F)N=CO2 |
Computed by PubChem (NCBI)