Products 1380087-86-4
CAS 1380087-86-4 appears in our catalog under these names: CPI-268456, CPI–268456, BRD4-IN-3. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 1 mg.
2-[(4S)-8-chloro-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetamide (CAS 1380087-86-4) is a chemical compound with the molecular formula C20H15Cl2N3O2 and a molecular weight of 400.3 g/mol. IUPAC name: 2-[(4S)-8-chloro-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetamide. InChIKey: RKYPLOAYXFDLOF-INIZCTEOSA-N.
| Molecular formula | C20H15Cl2N3O2 |
|---|---|
| Molecular weight | 400.3 g/mol |
| IUPAC name | 2-[(4S)-8-chloro-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetamide |
| InChIKey | RKYPLOAYXFDLOF-INIZCTEOSA-N |
| SMILES | CC1=NOC2=C1C3=C(C=C(C=C3)Cl)C(=N[C@H]2CC(=O)N)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)