Products 1380089-34-8
CAS 1380089-34-8 is the registry number for (3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoxazol-5-yl)methyl acetate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazol-5-yl]methyl acetate (CAS 1380089-34-8) is a chemical compound with the molecular formula C13H20BNO5 and a molecular weight of 281.11 g/mol. IUPAC name: [3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazol-5-yl]methyl acetate. InChIKey: YRNILWIROPLDPN-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO5 |
|---|---|
| Molecular weight | 281.11 g/mol |
| IUPAC name | [3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazol-5-yl]methyl acetate |
| InChIKey | YRNILWIROPLDPN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(ON=C2C)COC(=O)C |
Computed by PubChem (NCBI)