CAS 1380171-04-9 is the registry number for N,N-bisBoc 2-Chlorosulfonylethylamine. Offered by: TRC. Available pack sizes: 5g.
Tert-butyl N-(2-chlorosulfonylethyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 1380171-04-9) is a chemical compound with the molecular formula C12H22ClNO6S and a molecular weight of 343.82 g/mol. IUPAC name: tert-butyl N-(2-chlorosulfonylethyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: GJKHVHIDCQEYHI-UHFFFAOYSA-N.
| Molecular formula | C12H22ClNO6S |
|---|---|
| Molecular weight | 343.82 g/mol |
| IUPAC name | tert-butyl N-(2-chlorosulfonylethyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | GJKHVHIDCQEYHI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CCS(=O)(=O)Cl)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)