Products 1380228-30-7
CAS 1380228-30-7 is the registry number for INU-152. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[2,4-difluoro-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]furan-3-sulfonamide (CAS 1380228-30-7) is a chemical compound with the molecular formula C20H13F2N7O3S and a molecular weight of 469.4 g/mol. IUPAC name: N-[2,4-difluoro-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]furan-3-sulfonamide. InChIKey: ACIXGVIVJZJKNT-UHFFFAOYSA-N.
| Molecular formula | C20H13F2N7O3S |
|---|---|
| Molecular weight | 469.4 g/mol |
| IUPAC name | N-[2,4-difluoro-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]furan-3-sulfonamide |
| InChIKey | ACIXGVIVJZJKNT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)NC2=C(C=CC(=C2F)NS(=O)(=O)C3=COC=C3)F)C4=C5C(=NC=N4)N=CN5 |
Computed by PubChem (NCBI)