CAS 13803-39-9 appears in our catalog under these names: 5–Phenyl–2–furaldehyde, 5-Phenyl-2-furaldehyde, 96%, 5-Phenylfuran-2-carbaldehyde 95%, 5-Phenyl-2-furaldehyde, 98%, 98%, 5-Phenyl-2-furaldehyde, 98%. Offered by: GLPBio, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g, 100mg, 10g.
5-phenylfuran-2-carbaldehyde (CAS 13803-39-9) is a chemical compound with the molecular formula C11H8O2 and a molecular weight of 172.18 g/mol. IUPAC name: 5-phenylfuran-2-carbaldehyde. InChIKey: BMJHNNPEPBZULA-UHFFFAOYSA-N.
| Molecular formula | C11H8O2 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 5-phenylfuran-2-carbaldehyde |
| InChIKey | BMJHNNPEPBZULA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(O2)C=O |
Computed by PubChem (NCBI)