CAS 1380317-28-1 appears in our catalog under these names: Momelotinib HCl, Momelotinib dihydrochloride, N-(Cyanomethyl)-4-(2-((4-morpholinophenyl)amino)pyrimidin-4-yl)benzamide dihydrochloride, 97%, 97%, Momelotinib (dihydrochloride), Momelotinib 2HCl, 97%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress, Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 1g, 250mg, 100 mg, 1 g, 250 mg.
N-(cyanomethyl)-4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]benzamide;dihydrochloride (CAS 1380317-28-1) is a chemical compound with the molecular formula C23H24Cl2N6O2 and a molecular weight of 487.4 g/mol. IUPAC name: N-(cyanomethyl)-4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]benzamide;dihydrochloride. InChIKey: IPNATXQRPWRHKD-UHFFFAOYSA-N.
| Molecular formula | C23H24Cl2N6O2 |
|---|---|
| Molecular weight | 487.4 g/mol |
| IUPAC name | N-(cyanomethyl)-4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]benzamide;dihydrochloride |
| InChIKey | IPNATXQRPWRHKD-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC=C(C=C2)NC3=NC=CC(=N3)C4=CC=C(C=C4)C(=O)NCC#N.Cl.Cl |
Computed by PubChem (NCBI)