Products 1380401-05-7
CAS 1380401-05-7 is the registry number for tert-Butyl 2-carbamoyl-1-methylhydrazine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(carbamoylamino)-N-methylcarbamate (CAS 1380401-05-7) is a chemical compound with the molecular formula C7H15N3O3 and a molecular weight of 189.21 g/mol. IUPAC name: tert-butyl N-(carbamoylamino)-N-methylcarbamate. InChIKey: WANFPGIBPMBGBW-UHFFFAOYSA-N.
| Molecular formula | C7H15N3O3 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | tert-butyl N-(carbamoylamino)-N-methylcarbamate |
| InChIKey | WANFPGIBPMBGBW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)NC(=O)N |
Computed by PubChem (NCBI)