CAS 1380435-69-7 appears in our catalog under these names: Perfluorophenyl,1-4-diboronic acid, 95%, (Perfluoro-1,4-phenylene)diboronic acid 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
(4-borono-2,3,5,6-tetrafluorophenyl)boronic acid (CAS 1380435-69-7) is a chemical compound with the molecular formula C6H4B2F4O4 and a molecular weight of 237.71 g/mol. IUPAC name: (4-borono-2,3,5,6-tetrafluorophenyl)boronic acid. InChIKey: XFMHMVKSMSUKNF-UHFFFAOYSA-N.
| Molecular formula | C6H4B2F4O4 |
|---|---|
| Molecular weight | 237.71 g/mol |
| IUPAC name | (4-borono-2,3,5,6-tetrafluorophenyl)boronic acid |
| InChIKey | XFMHMVKSMSUKNF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C(=C1F)F)B(O)O)F)F)(O)O |
Computed by PubChem (NCBI)