CAS 1380491-70-2 appears in our catalog under these names: Tolterodine Impurity ((R)-5-Isopropylcarbonyloxymethyl Tolterodine), (R)-5-Isopropylcarbonyloxymethyl Tolterodine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
[3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxyphenyl]methyl 2-methylpropanoate (CAS 1380491-70-2) is a chemical compound with the molecular formula C26H37NO3 and a molecular weight of 411.6 g/mol. IUPAC name: [3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxyphenyl]methyl 2-methylpropanoate. InChIKey: UEMMFPSHISRHIK-HSZRJFAPSA-N.
| Molecular formula | C26H37NO3 |
|---|---|
| Molecular weight | 411.6 g/mol |
| IUPAC name | [3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxyphenyl]methyl 2-methylpropanoate |
| InChIKey | UEMMFPSHISRHIK-HSZRJFAPSA-N |
| SMILES | CC(C)C(=O)OCC1=CC(=C(C=C1)O)[C@H](CCN(C(C)C)C(C)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)