Products 138052-46-7
CAS 138052-46-7 appears in our catalog under these names: (2R,3R,4R)–2–((R)–1,2–dihydroxyethyl)–5–methoxytetrahydrofuran–3,4–diol, Methyl D-glucofuranoside, Methyl D-glucofuranoside, 97.00%. Offered by: GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 250mg, 50mg, 500mg.
(2R,3R,4R)-2-[(1R)-1,2-dihydroxyethyl]-5-methoxyoxolane-3,4-diol (CAS 138052-46-7) is a chemical compound with the molecular formula C7H14O6 and a molecular weight of 194.18 g/mol. IUPAC name: (2R,3R,4R)-2-[(1R)-1,2-dihydroxyethyl]-5-methoxyoxolane-3,4-diol. InChIKey: ZSQBOIUCEISYSW-YDEIVXIUSA-N.
| Molecular formula | C7H14O6 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | (2R,3R,4R)-2-[(1R)-1,2-dihydroxyethyl]-5-methoxyoxolane-3,4-diol |
| InChIKey | ZSQBOIUCEISYSW-YDEIVXIUSA-N |
| SMILES | COC1[C@@H]([C@H]([C@H](O1)[C@@H](CO)O)O)O |
Computed by PubChem (NCBI)