Products 1380537-63-2
CAS 1380537-63-2 is the registry number for tert-butyl 5-chlorospiro[3H-furo[2,3-c]pyridine-2,4'-piperidine]-1'-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl 5-chlorospiro[3H-furo[2,3-c]pyridine-2,4'-piperidine]-1'-carboxylate (CAS 1380537-63-2) is a chemical compound with the molecular formula C16H21ClN2O3 and a molecular weight of 324.80 g/mol. IUPAC name: tert-butyl 5-chlorospiro[3H-furo[2,3-c]pyridine-2,4'-piperidine]-1'-carboxylate. InChIKey: MBJDULFJTJURHG-UHFFFAOYSA-N.
| Molecular formula | C16H21ClN2O3 |
|---|---|
| Molecular weight | 324.80 g/mol |
| IUPAC name | tert-butyl 5-chlorospiro[3H-furo[2,3-c]pyridine-2,4'-piperidine]-1'-carboxylate |
| InChIKey | MBJDULFJTJURHG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC3=CC(=NC=C3O2)Cl |
Computed by PubChem (NCBI)