Products 1380539-08-1
CAS 1380539-08-1 is the registry number for Fosciclopirox (disodium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Disodium;(2-cyclohexyl-4-methyl-6-oxo-1-pyridinyl)oxymethyl phosphate (CAS 1380539-08-1) is a chemical compound with the molecular formula C13H18NNa2O6P and a molecular weight of 361.24 g/mol. IUPAC name: disodium;(2-cyclohexyl-4-methyl-6-oxo-1-pyridinyl)oxymethyl phosphate. InChIKey: AHWIDGSXKWSLQJ-UHFFFAOYSA-L.
| Molecular formula | C13H18NNa2O6P |
|---|---|
| Molecular weight | 361.24 g/mol |
| IUPAC name | disodium;(2-cyclohexyl-4-methyl-6-oxo-1-pyridinyl)oxymethyl phosphate |
| InChIKey | AHWIDGSXKWSLQJ-UHFFFAOYSA-L |
| SMILES | CC1=CC(=O)N(C(=C1)C2CCCCC2)OCOP(=O)([O-])[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)