CAS 1380672-71-8 appears in our catalog under these names: N-(2-Chlorophenyl)-5-(methylsulfonyl)picolinamide, 95%, N–(2–Chlorophenyl)–5–(methylsulfonyl)picolinamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg.
N-(2-chlorophenyl)-5-methylsulfonylpyridine-2-carboxamide (CAS 1380672-71-8) is a chemical compound with the molecular formula C13H11ClN2O3S and a molecular weight of 310.76 g/mol. IUPAC name: N-(2-chlorophenyl)-5-methylsulfonylpyridine-2-carboxamide. InChIKey: RNNKJSAEIXKTGL-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O3S |
|---|---|
| Molecular weight | 310.76 g/mol |
| IUPAC name | N-(2-chlorophenyl)-5-methylsulfonylpyridine-2-carboxamide |
| InChIKey | RNNKJSAEIXKTGL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CN=C(C=C1)C(=O)NC2=CC=CC=C2Cl |
Computed by PubChem (NCBI)