Products 138086-00-7
CAS 138086-00-7 is the registry number for Zelandopam (anhydrous). Offered by: MedChemExpress. Available pack sizes: Get quote.
(4S)-4-(3,4-dihydroxyphenyl)-1,2,3,4-tetrahydroisoquinoline-7,8-diol;hydrate;hydrochloride (CAS 138086-00-7) is a chemical compound with the molecular formula C15H18ClNO5 and a molecular weight of 327.76 g/mol. IUPAC name: (4S)-4-(3,4-dihydroxyphenyl)-1,2,3,4-tetrahydroisoquinoline-7,8-diol;hydrate;hydrochloride. InChIKey: KFGFDNWWVXERDQ-XRIOVQLTSA-N.
| Molecular formula | C15H18ClNO5 |
|---|---|
| Molecular weight | 327.76 g/mol |
| IUPAC name | (4S)-4-(3,4-dihydroxyphenyl)-1,2,3,4-tetrahydroisoquinoline-7,8-diol;hydrate;hydrochloride |
| InChIKey | KFGFDNWWVXERDQ-XRIOVQLTSA-N |
| SMILES | C1[C@H](C2=C(CN1)C(=C(C=C2)O)O)C3=CC(=C(C=C3)O)O.O.Cl |
Computed by PubChem (NCBI)