Products 138124-05-7
CAS 138124-05-7 is the registry number for (3aS,7aR)-3,3a,7,7a-Tetrahydroisobenzofuran-1(6H)-one, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3aS,7aR)-3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one (CAS 138124-05-7) is a chemical compound with the molecular formula C8H10O2 and a molecular weight of 138.16 g/mol. IUPAC name: (3aS,7aR)-3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one. InChIKey: GEWKOBVSQGLPLX-RNFRBKRXSA-N.
| Molecular formula | C8H10O2 |
|---|---|
| Molecular weight | 138.16 g/mol |
| IUPAC name | (3aS,7aR)-3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one |
| InChIKey | GEWKOBVSQGLPLX-RNFRBKRXSA-N |
| SMILES | C1C[C@@H]2[C@@H](COC2=O)C=C1 |
Computed by PubChem (NCBI)