CAS 13814-01-2 appears in our catalog under these names: Ammonium-d8 Sulfate, 98 atom % D, min 98% Chemical Purity, Ammoniumsulfate-d8 98 atom % D, (AMMONIUM SULFATE)-D8, 98+ ATOM % D, Ammonium sulphate-d8, 99.6%. Offered by: CDN, Deutero, Sigma-Aldrich, MedChemExpress. Available pack sizes: 5g, 1g, 1 g, 500 mg, 5 g.
Bis(tetradeuterioazanium);sulfate (CAS 13814-01-2) is a chemical compound with the molecular formula H8N2O4S and a molecular weight of 140.19 g/mol. IUPAC name: bis(tetradeuterioazanium);sulfate. InChIKey: BFNBIHQBYMNNAN-KTOHAENGSA-N.
| Molecular formula | H8N2O4S |
|---|---|
| Molecular weight | 140.19 g/mol |
| IUPAC name | bis(tetradeuterioazanium);sulfate |
| InChIKey | BFNBIHQBYMNNAN-KTOHAENGSA-N |
| SMILES | [2H][N+]([2H])([2H])[2H].[2H][N+]([2H])([2H])[2H].[O-]S(=O)(=O)[O-] |
Computed by PubChem (NCBI)