CAS 138167-87-0 is the registry number for 2,5-Dimethyl-4-hydroxy-3(2H)-furanone-13C2. Offered by: TRC. Available pack sizes: 25mg.
4-hydroxy-2,5-di((113C)methyl)furan-3-one (CAS 138167-87-0) is a chemical compound with the molecular formula C6H8O3 and a molecular weight of 130.11 g/mol. IUPAC name: 4-hydroxy-2,5-di((113C)methyl)furan-3-one. InChIKey: INAXVXBDKKUCGI-ZDOIIHCHSA-N.
| Molecular formula | C6H8O3 |
|---|---|
| Molecular weight | 130.11 g/mol |
| IUPAC name | 4-hydroxy-2,5-di((113C)methyl)furan-3-one |
| InChIKey | INAXVXBDKKUCGI-ZDOIIHCHSA-N |
| SMILES | [13CH3]C1C(=O)C(=C(O1)[13CH3])O |
Computed by PubChem (NCBI)