CAS 138182-19-1 is the registry number for 6-Chloro-1H-indol-3-yl b-D-glucuronide. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg, 100mg.
6-[(6-chloro-1H-indol-3-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (CAS 138182-19-1) is a chemical compound with the molecular formula C14H14ClNO7 and a molecular weight of 343.71 g/mol. IUPAC name: 6-[(6-chloro-1H-indol-3-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid. InChIKey: UFBPRKNLSYGHJJ-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO7 |
|---|---|
| Molecular weight | 343.71 g/mol |
| IUPAC name | 6-[(6-chloro-1H-indol-3-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | UFBPRKNLSYGHJJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC=C2OC3C(C(C(C(O3)C(=O)O)O)O)O |
Computed by PubChem (NCBI)