Products 1381944-21-3

CAS 1381944-21-3 is the registry number for Dimethyl 3-chloro-3'-fluorobiphenyl-4,5'-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2-chloro-4-(3-fluoro-5-methoxycarbonylphenyl)benzoate (CAS 1381944-21-3) is a chemical compound with the molecular formula C16H12ClFO4 and a molecular weight of 322.71 g/mol. IUPAC name: methyl 2-chloro-4-(3-fluoro-5-methoxycarbonylphenyl)benzoate. InChIKey: UUJJKQKQZMESAZ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12ClFO4
Molecular weight322.71 g/mol
IUPAC namemethyl 2-chloro-4-(3-fluoro-5-methoxycarbonylphenyl)benzoate
InChIKeyUUJJKQKQZMESAZ-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C(C=C1)C2=CC(=CC(=C2)F)C(=O)OC)Cl

Computed by PubChem (NCBI)