CAS 1381944-29-1 is the registry number for 2-Fluoro-4-[4-(methylsulfanyl)phenyl]benzonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-fluoro-4-(4-methylsulfanylphenyl)benzonitrile (CAS 1381944-29-1) is a chemical compound with the molecular formula C14H10FNS and a molecular weight of 243.30 g/mol. IUPAC name: 2-fluoro-4-(4-methylsulfanylphenyl)benzonitrile. InChIKey: WSYKTWQDJFYUPX-UHFFFAOYSA-N.
| Molecular formula | C14H10FNS |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 2-fluoro-4-(4-methylsulfanylphenyl)benzonitrile |
| InChIKey | WSYKTWQDJFYUPX-UHFFFAOYSA-N |
| SMILES | CSC1=CC=C(C=C1)C2=CC(=C(C=C2)C#N)F |
Computed by PubChem (NCBI)