CAS 1381944-35-9 appears in our catalog under these names: Methyl 4-fluoro-3-(4-methoxyphenyl)benzoate, 98%, Methyl 6-fluoro-4'-methoxy-(1,1'-biphenyl)-3-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Methyl 4-fluoro-3-(4-methoxyphenyl)benzoate (CAS 1381944-35-9) is a chemical compound with the molecular formula C15H13FO3 and a molecular weight of 260.26 g/mol. IUPAC name: methyl 4-fluoro-3-(4-methoxyphenyl)benzoate. InChIKey: YJOMALXZPDTYEO-UHFFFAOYSA-N.
| Molecular formula | C15H13FO3 |
|---|---|
| Molecular weight | 260.26 g/mol |
| IUPAC name | methyl 4-fluoro-3-(4-methoxyphenyl)benzoate |
| InChIKey | YJOMALXZPDTYEO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C=CC(=C2)C(=O)OC)F |
Computed by PubChem (NCBI)