Products 1381944-41-7

CAS 1381944-41-7 is the registry number for 3-[3-(Benzyloxy)phenyl]-2-fluorobenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-fluoro-3-(3-phenylmethoxyphenyl)benzoic acid (CAS 1381944-41-7) is a chemical compound with the molecular formula C20H15FO3 and a molecular weight of 322.3 g/mol. IUPAC name: 2-fluoro-3-(3-phenylmethoxyphenyl)benzoic acid. InChIKey: ZWXCDLKKNAIJMT-UHFFFAOYSA-N.

Identity
Molecular formulaC20H15FO3
Molecular weight322.3 g/mol
IUPAC name2-fluoro-3-(3-phenylmethoxyphenyl)benzoic acid
InChIKeyZWXCDLKKNAIJMT-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=CC=CC(=C2)C3=C(C(=CC=C3)C(=O)O)F

Computed by PubChem (NCBI)