CAS 1381944-44-0 is the registry number for 4-Bromo-2,3-difluoro-N-methyl-6-nitroaniline, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
4-bromo-2,3-difluoro-N-methyl-6-nitroaniline (CAS 1381944-44-0) is a chemical compound with the molecular formula C7H5BrF2N2O2 and a molecular weight of 267.03 g/mol. IUPAC name: 4-bromo-2,3-difluoro-N-methyl-6-nitroaniline. InChIKey: FXWJIGIKWQZDQR-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF2N2O2 |
|---|---|
| Molecular weight | 267.03 g/mol |
| IUPAC name | 4-bromo-2,3-difluoro-N-methyl-6-nitroaniline |
| InChIKey | FXWJIGIKWQZDQR-UHFFFAOYSA-N |
| SMILES | CNC1=C(C(=C(C=C1[N+](=O)[O-])Br)F)F |
Computed by PubChem (NCBI)