CAS 1381944-56-4 is the registry number for Methyl 3-[4-(ethoxycarbonyl)-3-fluorophenyl]-2-fluorobenzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Methyl 3-(4-ethoxycarbonyl-3-fluorophenyl)-2-fluorobenzoate (CAS 1381944-56-4) is a chemical compound with the molecular formula C17H14F2O4 and a molecular weight of 320.29 g/mol. IUPAC name: methyl 3-(4-ethoxycarbonyl-3-fluorophenyl)-2-fluorobenzoate. InChIKey: AMBBTDZBXSSSBH-UHFFFAOYSA-N.
| Molecular formula | C17H14F2O4 |
|---|---|
| Molecular weight | 320.29 g/mol |
| IUPAC name | methyl 3-(4-ethoxycarbonyl-3-fluorophenyl)-2-fluorobenzoate |
| InChIKey | AMBBTDZBXSSSBH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)C2=C(C(=CC=C2)C(=O)OC)F)F |
Computed by PubChem (NCBI)