CAS 1381944-86-0 is the registry number for 4-Cyano-3,3'-difluoro-4'-methylbiphenyl, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-fluoro-4-(3-fluoro-4-methylphenyl)benzonitrile (CAS 1381944-86-0) is a chemical compound with the molecular formula C14H9F2N and a molecular weight of 229.22 g/mol. IUPAC name: 2-fluoro-4-(3-fluoro-4-methylphenyl)benzonitrile. InChIKey: YCRBIMAMFQJRTM-UHFFFAOYSA-N.
| Molecular formula | C14H9F2N |
|---|---|
| Molecular weight | 229.22 g/mol |
| IUPAC name | 2-fluoro-4-(3-fluoro-4-methylphenyl)benzonitrile |
| InChIKey | YCRBIMAMFQJRTM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC(=C(C=C2)C#N)F)F |
Computed by PubChem (NCBI)