CAS 1381947-71-2 is the registry number for 2,5–dibromothiophene–3,4–d2. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
2,5-dibromo-3,4-dideuteriothiophene (CAS 1381947-71-2) is a chemical compound with the molecular formula C4H2Br2S and a molecular weight of 243.95 g/mol. IUPAC name: 2,5-dibromo-3,4-dideuteriothiophene. InChIKey: KBVDUUXRXJTAJC-QDNHWIQGSA-N.
| Molecular formula | C4H2Br2S |
|---|---|
| Molecular weight | 243.95 g/mol |
| IUPAC name | 2,5-dibromo-3,4-dideuteriothiophene |
| InChIKey | KBVDUUXRXJTAJC-QDNHWIQGSA-N |
| SMILES | [2H]C1=C(SC(=C1[2H])Br)Br |
Computed by PubChem (NCBI)