CAS 1382981-69-2 is the registry number for 2-(2,6-Dichloro-9-(tetrahydro-2H-pyran-2-yl)-9H-purin-8-yl)propan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2,6-dichloro-9-(oxan-2-yl)purin-8-yl]propan-2-ol (CAS 1382981-69-2) is a chemical compound with the molecular formula C13H16Cl2N4O2 and a molecular weight of 331.19 g/mol. IUPAC name: 2-[2,6-dichloro-9-(oxan-2-yl)purin-8-yl]propan-2-ol. InChIKey: ALLGQMUTMOBKJX-UHFFFAOYSA-N.
| Molecular formula | C13H16Cl2N4O2 |
|---|---|
| Molecular weight | 331.19 g/mol |
| IUPAC name | 2-[2,6-dichloro-9-(oxan-2-yl)purin-8-yl]propan-2-ol |
| InChIKey | ALLGQMUTMOBKJX-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=NC2=C(N1C3CCCCO3)N=C(N=C2Cl)Cl)O |
Computed by PubChem (NCBI)