CAS 1382981-73-8 appears in our catalog under these names: 2,4-Dichloro-6,6-dimethyl-8,9-dihydro-6H-(1,4)oxazino(4,3-e)purine, 98%, 2,4-Dichloro-6,6-dimethyl-8,9-dihydro-6H-[1,4]oxazino[4,3-e]purine, ≥95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
2,4-dichloro-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazine (CAS 1382981-73-8) is a chemical compound with the molecular formula C10H10Cl2N4O and a molecular weight of 273.12 g/mol. IUPAC name: 2,4-dichloro-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazine. InChIKey: PGIQVXSIWIPFGQ-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N4O |
|---|---|
| Molecular weight | 273.12 g/mol |
| IUPAC name | 2,4-dichloro-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazine |
| InChIKey | PGIQVXSIWIPFGQ-UHFFFAOYSA-N |
| SMILES | CC1(C2=NC3=C(N2CCO1)N=C(N=C3Cl)Cl)C |
Computed by PubChem (NCBI)