CAS 1383544-71-5 appears in our catalog under these names: Azd-amido-phenyl-azide, 95%, AZD–CO–C2–Ph–amido–Ph–azide, AZD-CO-C2-Ph-amido-Ph-azide. Offered by: Combi-blocks, GLPBio, MedChemExpress. Available pack sizes: 100mg, 250mg, Get quote.
4-azido-N-[4-[3-oxo-3-(2-oxoazetidin-1-yl)propyl]phenyl]benzamide (CAS 1383544-71-5) is a chemical compound with the molecular formula C19H17N5O3 and a molecular weight of 363.4 g/mol. IUPAC name: 4-azido-N-[4-[3-oxo-3-(2-oxoazetidin-1-yl)propyl]phenyl]benzamide. InChIKey: ZGNPLPRYBYXYMB-UHFFFAOYSA-N.
| Molecular formula | C19H17N5O3 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 4-azido-N-[4-[3-oxo-3-(2-oxoazetidin-1-yl)propyl]phenyl]benzamide |
| InChIKey | ZGNPLPRYBYXYMB-UHFFFAOYSA-N |
| SMILES | C1CN(C1=O)C(=O)CCC2=CC=C(C=C2)NC(=O)C3=CC=C(C=C3)N=[N+]=[N-] |
Computed by PubChem (NCBI)