Products 1383727-17-0
CAS 1383727-17-0 is the registry number for SC-2001, 99.37%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 50 mg, 25 mg, 10mM/1mL.
(2E)-5-bromo-2-[(5Z)-4-methoxy-5-(1H-pyrrol-2-ylmethylidene)pyrrol-2-ylidene]indole (CAS 1383727-17-0) is a chemical compound with the molecular formula C18H14BrN3O and a molecular weight of 368.2 g/mol. IUPAC name: (2E)-5-bromo-2-[(5Z)-4-methoxy-5-(1H-pyrrol-2-ylmethylidene)pyrrol-2-ylidene]indole. InChIKey: HQULZCASURMKEF-LVRQTRGPSA-N.
| Molecular formula | C18H14BrN3O |
|---|---|
| Molecular weight | 368.2 g/mol |
| IUPAC name | (2E)-5-bromo-2-[(5Z)-4-methoxy-5-(1H-pyrrol-2-ylmethylidene)pyrrol-2-ylidene]indole |
| InChIKey | HQULZCASURMKEF-LVRQTRGPSA-N |
| SMILES | COC\1=C/C(=C\2/C=C3C=C(C=CC3=N2)Br)/N/C1=C\C4=CC=CN4 |
Computed by PubChem (NCBI)