CAS 78860-87-4 is the registry number for 3-(4-bromophenyl)-5-indol-3-yl-1H,4H,5H-1,2-diazin-6-one. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg.
3-(4-bromophenyl)-5-(1H-indol-3-yl)-4,5-dihydro-1H-pyridazin-6-one (CAS 78860-87-4) is a chemical compound with the molecular formula C18H14BrN3O and a molecular weight of 368.2 g/mol. IUPAC name: 3-(4-bromophenyl)-5-(1H-indol-3-yl)-4,5-dihydro-1H-pyridazin-6-one. InChIKey: SGTXSZOIIFWIAD-UHFFFAOYSA-N.
| Molecular formula | C18H14BrN3O |
|---|---|
| Molecular weight | 368.2 g/mol |
| IUPAC name | 3-(4-bromophenyl)-5-(1H-indol-3-yl)-4,5-dihydro-1H-pyridazin-6-one |
| InChIKey | SGTXSZOIIFWIAD-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)NN=C1C2=CC=C(C=C2)Br)C3=CNC4=CC=CC=C43 |
Computed by PubChem (NCBI)