CAS 1383789-11-4 is the registry number for 3-Chloro-2,5,6-trimethoxyisonicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
3-chloro-2,5,6-trimethoxypyridine-4-carboxylic acid (CAS 1383789-11-4) is a chemical compound with the molecular formula C9H10ClNO5 and a molecular weight of 247.63 g/mol. IUPAC name: 3-chloro-2,5,6-trimethoxypyridine-4-carboxylic acid. InChIKey: OYXIUWKKALTRAS-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO5 |
|---|---|
| Molecular weight | 247.63 g/mol |
| IUPAC name | 3-chloro-2,5,6-trimethoxypyridine-4-carboxylic acid |
| InChIKey | OYXIUWKKALTRAS-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(N=C1OC)OC)Cl)C(=O)O |
Computed by PubChem (NCBI)