Products 1383789-11-4

CAS 1383789-11-4 is the registry number for 3-Chloro-2,5,6-trimethoxyisonicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-chloro-2,5,6-trimethoxypyridine-4-carboxylic acid (CAS 1383789-11-4) is a chemical compound with the molecular formula C9H10ClNO5 and a molecular weight of 247.63 g/mol. IUPAC name: 3-chloro-2,5,6-trimethoxypyridine-4-carboxylic acid. InChIKey: OYXIUWKKALTRAS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClNO5
Molecular weight247.63 g/mol
IUPAC name3-chloro-2,5,6-trimethoxypyridine-4-carboxylic acid
InChIKeyOYXIUWKKALTRAS-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(N=C1OC)OC)Cl)C(=O)O

Computed by PubChem (NCBI)