Products 138384-68-6
CAS 138384-68-6 is the registry number for Metesind. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-N-methyl-6-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]benzo[cd]indole-2,6-diamine (CAS 138384-68-6) is a chemical compound with the molecular formula C23H24N4O3S and a molecular weight of 436.5 g/mol. IUPAC name: 6-N-methyl-6-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]benzo[cd]indole-2,6-diamine. InChIKey: CVEGTZWWWRJCFK-UHFFFAOYSA-N.
| Molecular formula | C23H24N4O3S |
|---|---|
| Molecular weight | 436.5 g/mol |
| IUPAC name | 6-N-methyl-6-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]benzo[cd]indole-2,6-diamine |
| InChIKey | CVEGTZWWWRJCFK-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=C(C=C1)S(=O)(=O)N2CCOCC2)C3=C4C=CC=C5C4=C(C=C3)N=C5N |
Computed by PubChem (NCBI)