CAS 1383852-06-9 appears in our catalog under these names: 4-Chloro-2-cyclopropyl-5-methoxyaniline, 95%, 4-Chloro-2-cyclopropyl-5-methoxyaniline, 95+%, 4-Chloro-2-cyclopropyl-5-methoxyaniline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 10g, 250mg, 1g, 0,5g, 50mg.
4-chloro-2-cyclopropyl-5-methoxyaniline (CAS 1383852-06-9) is a chemical compound with the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. IUPAC name: 4-chloro-2-cyclopropyl-5-methoxyaniline. InChIKey: GDGQODDLOUWOLH-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 4-chloro-2-cyclopropyl-5-methoxyaniline |
| InChIKey | GDGQODDLOUWOLH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)N)C2CC2)Cl |
Computed by PubChem (NCBI)