CAS 1383937-03-8 appears in our catalog under these names: 3'-Azido-ddATP sodium solution (100mM), 98.88%, 3'-Azido-2'3'-ddATP, ≥95 %, 10 µl, plastic, 3'-Azido-2'3'-ddATP, ≥95 %, 50 µl, plastic. Offered by: MedChemExpress, Roth. Available pack sizes: 100 μL, 10µl, 50µl.
CAS 1383937-03-8 identifies a chemical compound with the molecular formula C10H15N8NaO11P3 and a molecular weight of 539.18 g/mol. InChIKey: VRHIBBBBGVIKNF-VWZUFWLJSA-N.
| Molecular formula | C10H15N8NaO11P3 |
|---|---|
| Molecular weight | 539.18 g/mol |
| InChIKey | VRHIBBBBGVIKNF-VWZUFWLJSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N=[N+]=[N-].[Na] |
Computed by PubChem (NCBI)