CAS 1384080-56-1 appears in our catalog under these names: (1S)-3-(dimethylamino)-1-(thiophen-3-yl)propan-1-ol, 98%, Duloxetine Impurity 19, Duloxetine Impurity 21. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(1S)-3-(dimethylamino)-1-thiophen-3-ylpropan-1-ol (CAS 1384080-56-1) is a chemical compound with the molecular formula C9H15NOS and a molecular weight of 185.29 g/mol. IUPAC name: (1S)-3-(dimethylamino)-1-thiophen-3-ylpropan-1-ol. InChIKey: HKVIPLMMUMBSKB-VIFPVBQESA-N.
| Molecular formula | C9H15NOS |
|---|---|
| Molecular weight | 185.29 g/mol |
| IUPAC name | (1S)-3-(dimethylamino)-1-thiophen-3-ylpropan-1-ol |
| InChIKey | HKVIPLMMUMBSKB-VIFPVBQESA-N |
| SMILES | CN(C)CC[C@@H](C1=CSC=C1)O |
Computed by PubChem (NCBI)