CAS 1384082-96-5 appears in our catalog under these names: (1α,1'S,4β)–Lanabecestat, (1α,1'S,4β)-Lanabecestat, (1Alpha,1'S,4Beta)-Lanabecestat, (1α,1'S,4β)-Lanabecestat, 96.01%, 96.01%, (1α,1'S,4β)-Lanabecestat, 96.01%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 2mg, 50mg, 100mg, 10mg, 10mM (in 1ml dmso), 25mg, 5 mg.
CAS 1384082-96-5 identifies a chemical compound with the molecular formula C26H28N4O and a molecular weight of 412.5 g/mol. InChIKey: WKDNQONLGXOZRG-TXDAUAKNSA-N.
| Molecular formula | C26H28N4O |
|---|---|
| Molecular weight | 412.5 g/mol |
| InChIKey | WKDNQONLGXOZRG-TXDAUAKNSA-N |
| SMILES | CC#CC1=CC(=CN=C1)C2=CC3=C(CC4([C@@]35N=C(C(=N5)N)C)CCC(CC4)OC)C=C2 |
Computed by PubChem (NCBI)