CAS 1384122-86-4 appears in our catalog under these names: N–((4–Methoxybenzyl)oxy)–2–nitrobenzenesulfonamide, N-((4-Methoxybenzyl)oxy)-2-nitrobenzenesulfonamide, 97%. Offered by: GLPBio, AmBeed. Available pack sizes: 1g, 5g, 250mg.
N-[(4-methoxyphenyl)methoxy]-2-nitrobenzenesulfonamide (CAS 1384122-86-4) is a chemical compound with the molecular formula C14H14N2O6S and a molecular weight of 338.34 g/mol. IUPAC name: N-[(4-methoxyphenyl)methoxy]-2-nitrobenzenesulfonamide. InChIKey: MTVNGWUZKIOSEX-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O6S |
|---|---|
| Molecular weight | 338.34 g/mol |
| IUPAC name | N-[(4-methoxyphenyl)methoxy]-2-nitrobenzenesulfonamide |
| InChIKey | MTVNGWUZKIOSEX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CONS(=O)(=O)C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)