CAS 138421-34-8 is the registry number for Rel-(4S,5S)-1,3-dibenzyl-4,5-diphenyl-1,3,2-diazaphospholidine 2-oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S,5S)-1,3-dibenzyl-4,5-diphenyl-1,3,2-diazaphospholidin-2-ium 2-oxide (CAS 138421-34-8) is a chemical compound with the molecular formula C28H26N2OP+ and a molecular weight of 437.5 g/mol. IUPAC name: (4S,5S)-1,3-dibenzyl-4,5-diphenyl-1,3,2-diazaphospholidin-2-ium 2-oxide. InChIKey: PQOWIURFGWDNSV-NSOVKSMOSA-N.
| Molecular formula | C28H26N2OP+ |
|---|---|
| Molecular weight | 437.5 g/mol |
| IUPAC name | (4S,5S)-1,3-dibenzyl-4,5-diphenyl-1,3,2-diazaphospholidin-2-ium 2-oxide |
| InChIKey | PQOWIURFGWDNSV-NSOVKSMOSA-N |
| SMILES | C1=CC=C(C=C1)CN2[C@H]([C@@H](N([P+]2=O)CC3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)