Products 1384268-69-2
CAS 1384268-69-2 is the registry number for (R)-4-(3-chlorophenyl)pyrrolidin-2-one, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
(4R)-4-(3-chlorophenyl)pyrrolidin-2-one (CAS 1384268-69-2) is a chemical compound with the molecular formula C10H10ClNO and a molecular weight of 195.64 g/mol. IUPAC name: (4R)-4-(3-chlorophenyl)pyrrolidin-2-one. InChIKey: YGKWZVARCHRFLH-QMMMGPOBSA-N.
| Molecular formula | C10H10ClNO |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | (4R)-4-(3-chlorophenyl)pyrrolidin-2-one |
| InChIKey | YGKWZVARCHRFLH-QMMMGPOBSA-N |
| SMILES | C1[C@@H](CNC1=O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)