Products 915865-96-2

CAS 915865-96-2 is the registry number for 6-Methoxyisoquinoline hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

6-methoxyisoquinoline;hydrochloride (CAS 915865-96-2) is a chemical compound with the molecular formula C10H10ClNO and a molecular weight of 195.64 g/mol. IUPAC name: 6-methoxyisoquinoline;hydrochloride. InChIKey: MHJDVDRMCCCPHE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10ClNO
Molecular weight195.64 g/mol
IUPAC name6-methoxyisoquinoline;hydrochloride
InChIKeyMHJDVDRMCCCPHE-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C=C1)C=NC=C2.Cl

Computed by PubChem (NCBI)