CAS 915865-96-2 is the registry number for 6-Methoxyisoquinoline hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
6-methoxyisoquinoline;hydrochloride (CAS 915865-96-2) is a chemical compound with the molecular formula C10H10ClNO and a molecular weight of 195.64 g/mol. IUPAC name: 6-methoxyisoquinoline;hydrochloride. InChIKey: MHJDVDRMCCCPHE-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | 6-methoxyisoquinoline;hydrochloride |
| InChIKey | MHJDVDRMCCCPHE-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=NC=C2.Cl |
Computed by PubChem (NCBI)