CAS 1384427-41-1 is the registry number for N-Methyl((2,2,2-trifluoroethyl)sulfanyl)methanimidamide, trifluoromethanesulfonic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2,2-trifluoroethyl N'-methylcarbamimidothioate;trifluoromethanesulfonic acid (CAS 1384427-41-1) is a chemical compound with the molecular formula C5H8F6N2O3S2 and a molecular weight of 322.3 g/mol. IUPAC name: 2,2,2-trifluoroethyl N'-methylcarbamimidothioate;trifluoromethanesulfonic acid. InChIKey: ZBRXIFLTZJXACM-UHFFFAOYSA-N.
| Molecular formula | C5H8F6N2O3S2 |
|---|---|
| Molecular weight | 322.3 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N'-methylcarbamimidothioate;trifluoromethanesulfonic acid |
| InChIKey | ZBRXIFLTZJXACM-UHFFFAOYSA-N |
| SMILES | CN=C(N)SCC(F)(F)F.C(F)(F)(F)S(=O)(=O)O |
Computed by PubChem (NCBI)