CAS 1384428-37-8 is the registry number for 4-(Fluorosulfonyl)thiophene-2-carboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
4-fluorosulfonylthiophene-2-carboxylic acid (CAS 1384428-37-8) is a chemical compound with the molecular formula C5H3FO4S2 and a molecular weight of 210.2 g/mol. IUPAC name: 4-fluorosulfonylthiophene-2-carboxylic acid. InChIKey: VKBWICAAHPQULB-UHFFFAOYSA-N.
| Molecular formula | C5H3FO4S2 |
|---|---|
| Molecular weight | 210.2 g/mol |
| IUPAC name | 4-fluorosulfonylthiophene-2-carboxylic acid |
| InChIKey | VKBWICAAHPQULB-UHFFFAOYSA-N |
| SMILES | C1=C(SC=C1S(=O)(=O)F)C(=O)O |
Computed by PubChem (NCBI)