Products 1384428-37-8

CAS 1384428-37-8 is the registry number for 4-(Fluorosulfonyl)thiophene-2-carboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-fluorosulfonylthiophene-2-carboxylic acid (CAS 1384428-37-8) is a chemical compound with the molecular formula C5H3FO4S2 and a molecular weight of 210.2 g/mol. IUPAC name: 4-fluorosulfonylthiophene-2-carboxylic acid. InChIKey: VKBWICAAHPQULB-UHFFFAOYSA-N.

Identity
Molecular formulaC5H3FO4S2
Molecular weight210.2 g/mol
IUPAC name4-fluorosulfonylthiophene-2-carboxylic acid
InChIKeyVKBWICAAHPQULB-UHFFFAOYSA-N
SMILESC1=C(SC=C1S(=O)(=O)F)C(=O)O

Computed by PubChem (NCBI)