CAS 1384428-39-0 appears in our catalog under these names: 1-(4-Methoxy-3-(1H-pyrazol-1-ylmethyl)phenyl)ethan-1-amine dihydrochloride, 95%, 1-{4-Methoxy-3-((1H-pyrazol-1-yl)methyl)phenyl}ethan-1-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-[4-methoxy-3-(pyrazol-1-ylmethyl)phenyl]ethanamine;dihydrochloride (CAS 1384428-39-0) is a chemical compound with the molecular formula C13H19Cl2N3O and a molecular weight of 304.21 g/mol. IUPAC name: 1-[4-methoxy-3-(pyrazol-1-ylmethyl)phenyl]ethanamine;dihydrochloride. InChIKey: QIBNVALVMYBGLP-UHFFFAOYSA-N.
| Molecular formula | C13H19Cl2N3O |
|---|---|
| Molecular weight | 304.21 g/mol |
| IUPAC name | 1-[4-methoxy-3-(pyrazol-1-ylmethyl)phenyl]ethanamine;dihydrochloride |
| InChIKey | QIBNVALVMYBGLP-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)OC)CN2C=CC=N2)N.Cl.Cl |
Computed by PubChem (NCBI)