Products 1384429-35-9

CAS 1384429-35-9 is the registry number for 2-Cyano-4-fluoro-6-methylbenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-cyano-4-fluoro-6-methylbenzenesulfonyl chloride (CAS 1384429-35-9) is a chemical compound with the molecular formula C8H5ClFNO2S and a molecular weight of 233.65 g/mol. IUPAC name: 2-cyano-4-fluoro-6-methylbenzenesulfonyl chloride. InChIKey: OWRQVRQJLXABNC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClFNO2S
Molecular weight233.65 g/mol
IUPAC name2-cyano-4-fluoro-6-methylbenzenesulfonyl chloride
InChIKeyOWRQVRQJLXABNC-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1S(=O)(=O)Cl)C#N)F

Computed by PubChem (NCBI)