CAS 1384429-95-1 appears in our catalog under these names: 1-(1,3-Benzothiazol-2-yl)propan-2-amine dihydrochloride, 95%, 1-(1,3-Benzothiazol-2-yl)propan-2-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
1-(1,3-benzothiazol-2-yl)propan-2-amine;dihydrochloride (CAS 1384429-95-1) is a chemical compound with the molecular formula C10H14Cl2N2S and a molecular weight of 265.20 g/mol. IUPAC name: 1-(1,3-benzothiazol-2-yl)propan-2-amine;dihydrochloride. InChIKey: YOMGIENJBDTFCV-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N2S |
|---|---|
| Molecular weight | 265.20 g/mol |
| IUPAC name | 1-(1,3-benzothiazol-2-yl)propan-2-amine;dihydrochloride |
| InChIKey | YOMGIENJBDTFCV-UHFFFAOYSA-N |
| SMILES | CC(CC1=NC2=CC=CC=C2S1)N.Cl.Cl |
Computed by PubChem (NCBI)