CAS 1384430-07-2 is the registry number for 2-(Aminomethyl)-3-fluoro-N-methylbenzene-1-sulfonamide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(aminomethyl)-3-fluoro-N-methylbenzenesulfonamide;hydrochloride (CAS 1384430-07-2) is a chemical compound with the molecular formula C8H12ClFN2O2S and a molecular weight of 254.71 g/mol. IUPAC name: 2-(aminomethyl)-3-fluoro-N-methylbenzenesulfonamide;hydrochloride. InChIKey: VUEFVSOZQNZIOG-UHFFFAOYSA-N.
| Molecular formula | C8H12ClFN2O2S |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | 2-(aminomethyl)-3-fluoro-N-methylbenzenesulfonamide;hydrochloride |
| InChIKey | VUEFVSOZQNZIOG-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC=CC(=C1CN)F.Cl |
Computed by PubChem (NCBI)