Products 1384701-24-9
CAS 1384701-24-9 is the registry number for N-(2-Fluorobenzyl)-[1,2,4]triazolo[4,3-a]pyrazin-8-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(2-fluorophenyl)methyl]-[1,2,4]triazolo[4,3-a]pyrazin-8-amine (CAS 1384701-24-9) is a chemical compound with the molecular formula C12H10FN5 and a molecular weight of 243.24 g/mol. IUPAC name: N-[(2-fluorophenyl)methyl]-[1,2,4]triazolo[4,3-a]pyrazin-8-amine. InChIKey: WXKGWBJICXVJHY-UHFFFAOYSA-N.
| Molecular formula | C12H10FN5 |
|---|---|
| Molecular weight | 243.24 g/mol |
| IUPAC name | N-[(2-fluorophenyl)methyl]-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
| InChIKey | WXKGWBJICXVJHY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC2=NC=CN3C2=NN=C3)F |
Computed by PubChem (NCBI)